Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, COA of Formula: C9H9BrO2, 99548-55-7, Name is Methyl 4-bromo-2-methylbenzoate, SMILES is BrC1=CC(=C(C(=O)OC)C=C1)C, belongs to esters-buliding-blocks compound. In a document, author is Rauen, Patrick J., introduce the new discover.
Dihydropyracyloporphyrins
A pyrrole ethyl ester with a fused dihydropyracylene unit was prepared by reacting 5-nitro-1,2-dihydropyracylene with ethyl isocyanoacetate in the presence of a phosphazene base. Cleavage of the ester moiety, followed by reaction with an acetoxymethylpyrrole and acetic acid in refluxing ethanol, afforded a tripyrrane, and subsequent ‘3 + 1’ condensation with a pyrrole dialdehyde gave a dihydropyracyloporphyrin. Cyclotetramerization of the dihydropyracylopyrrole with benzaldehyde and BF3.Et2O gave a sterically crowded tetrakis(dihydropyracylo)-porphyrin and the reduced five-membered rings proved to be an excellent NMR probe for conformational mobility. The new porphyrins and their nickel(II) complexes also showed potentially valuable highly red shifted UV-vis spectra. (C) 2020 Elsevier Ltd. All rights reserved.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 99548-55-7 is helpful to your research. COA of Formula: C9H9BrO2.